C24H28N4O4 — CID 16681881
(8S)-7-[(2E,4Z)-hexa-2,4-dienoyl]-3-[3-[[(Z)-2-methylbut-2-enoyl]amino]phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide (PubChem CID 16681881) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is (8S)-7-[(2E,4Z)-hexa-2,4-dienoyl]-3-[3-[[(Z)-2-methylbut-2-enoyl]amino]phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide.
| Compound Name | (8S)-7-[(2E,4Z)-hexa-2,4-dienoyl]-3-[3-[[(Z)-2-methylbut-2-enoyl]amino]phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide |
|---|---|
| PubChem CID | 16681881 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | (8S)-7-[(2E,4Z)-hexa-2,4-dienoyl]-3-[3-[[(Z)-2-methylbut-2-enoyl]amino]phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide |
| SMILES | C/C=C\C=C\C(=O)N1CC2(CC(c3cccc(NC(=O)/C(C)=C\C)c3)=NO2)C[C@H]1C(N)=O |
| InChI | InChI=1S/C24H28N4O4/c1-4-6-7-11-21(29)28-15-24(14-20(28)22(25)30)13-19(27-32-24)17-9-8-10-18(12-17)26-23(31)16(3)5-2/h4-12,20H,13-15H2,1-3H3,(H2,25,30)(H,26,31)/b6-4-,11-7+,16-5-/t20-,24?/m0/s1 |
| InChIKey | HDEZDYWBJBSWFK-WNBZHJPXSA-N |
| XLogP | 2.67 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|