C22H27N5O4 — CID 16745479
(8R)-7-(2-cyanoacetyl)-3-[3-(hexanoylamino)phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide (PubChem CID 16745479) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is (8R)-7-(2-cyanoacetyl)-3-[3-(hexanoylamino)phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide.
| Compound Name | (8R)-7-(2-cyanoacetyl)-3-[3-(hexanoylamino)phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide |
|---|---|
| PubChem CID | 16745479 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (8R)-7-(2-cyanoacetyl)-3-[3-(hexanoylamino)phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide |
| SMILES | CCCCCC(=O)Nc1cccc(C2=NOC3(C2)C[C@H](C(N)=O)N(C(=O)CC#N)C3)c1 |
| InChI | InChI=1S/C22H27N5O4/c1-2-3-4-8-19(28)25-16-7-5-6-15(11-16)17-12-22(31-26-17)13-18(21(24)30)27(14-22)20(29)9-10-23/h5-7,11,18H,2-4,8-9,12-14H2,1H3,(H2,24,30)(H,25,28)/t18-,22?/m1/s1 |
| InChIKey | FERHLTXDCGFPRD-ZZWBGTBQSA-N |
| XLogP | 2.07 |
| TPSA | 137.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|