C25H25ClN4O4 — CID 16681905
(8R)-7-(4-chlorobenzoyl)-3-[3-[[(Z)-2-methylbut-2-enoyl]amino]phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide (PubChem CID 16681905) has the molecular formula C25H25ClN4O4 and a molecular weight of 480.95 g/mol. Its IUPAC name is (8R)-7-(4-chlorobenzoyl)-3-[3-[[(Z)-2-methylbut-2-enoyl]amino]phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide.
| Compound Name | (8R)-7-(4-chlorobenzoyl)-3-[3-[[(Z)-2-methylbut-2-enoyl]amino]phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide |
|---|---|
| PubChem CID | 16681905 |
| Molecular Formula | C25H25ClN4O4 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | (8R)-7-(4-chlorobenzoyl)-3-[3-[[(Z)-2-methylbut-2-enoyl]amino]phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide |
| SMILES | C/C=C(/C)C(=O)Nc1cccc(C2=NOC3(C2)C[C@H](C(N)=O)N(C(=O)c2ccc(Cl)cc2)C3)c1 |
| InChI | InChI=1S/C25H25ClN4O4/c1-3-15(2)23(32)28-19-6-4-5-17(11-19)20-12-25(34-29-20)13-21(22(27)31)30(14-25)24(33)16-7-9-18(26)10-8-16/h3-11,21H,12-14H2,1-2H3,(H2,27,31)(H,28,32)/b15-3-/t21-,25?/m1/s1 |
| InChIKey | JWZNBJZLUUNWGJ-UUHLDRHESA-N |
| XLogP | 3.51 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|