C13H12BrN3O3S — CID 16682047
1-[3-(4-nitrophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazol-4-ium-7-yl]ethanone bromide (PubChem CID 16682047) has the molecular formula C13H12BrN3O3S and a molecular weight of 370.23 g/mol. Its IUPAC name is 1-[3-(4-nitrophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazol-4-ium-7-yl]ethanone bromide.
| Compound Name | 1-[3-(4-nitrophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazol-4-ium-7-yl]ethanone bromide |
|---|---|
| PubChem CID | 16682047 |
| Molecular Formula | C13H12BrN3O3S |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 1-[3-(4-nitrophenyl)-5,6-dihydroimidazo[2,1-b][1,3]thiazol-4-ium-7-yl]ethanone bromide |
| SMILES | CC(=O)N1CC[n+]2c(-c3ccc([N+](=O)[O-])cc3)csc21.[Br-] |
| InChI | InChI=1S/C13H12N3O3S.BrH/c1-9(17)14-6-7-15-12(8-20-13(14)15)10-2-4-11(5-3-10)16(18)19;/h2-5,8H,6-7H2,1H3;1H/q+1;/p-1 |
| InChIKey | MPWCRWMXBMTQCJ-UHFFFAOYSA-M |
| XLogP | -1.02 |
| TPSA | 67.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|