C17H20S — CID 166826356
(2E,3E,5Z,7E)-7-methyl-2-(6-methylidenecyclohexa-2,4-dien-1-ylidene)nona-3,5,7-triene-4-thiol (PubChem CID 166826356) has the molecular formula C17H20S and a molecular weight of 256.41 g/mol. Its IUPAC name is (2E,3E,5Z,7E)-7-methyl-2-(6-methylidenecyclohexa-2,4-dien-1-ylidene)nona-3,5,7-triene-4-thiol.
| Compound Name | (2E,3E,5Z,7E)-7-methyl-2-(6-methylidenecyclohexa-2,4-dien-1-ylidene)nona-3,5,7-triene-4-thiol |
|---|---|
| PubChem CID | 166826356 |
| Molecular Formula | C17H20S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (2E,3E,5Z,7E)-7-methyl-2-(6-methylidenecyclohexa-2,4-dien-1-ylidene)nona-3,5,7-triene-4-thiol |
| SMILES | C=c1cccc/c1=C(C)\C=C(S)/C=C\C(C)=C\C |
| InChI | InChI=1S/C17H20S/c1-5-13(2)10-11-16(18)12-15(4)17-9-7-6-8-14(17)3/h5-12,18H,3H2,1-2,4H3/b11-10-,13-5+,16-12+,17-15+ |
| InChIKey | UTKCNJKPHNSTGX-QZHJJUHMSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|