C19H17Cl2N3O2 — CID 166828991
(1S,5R,6R,7S)-N-(5,6-dichloro-3-pyridinyl)-3-methyl-7-pyridin-4-yl-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide (PubChem CID 166828991) has the molecular formula C19H17Cl2N3O2 and a molecular weight of 390.27 g/mol. Its IUPAC name is (1S,5R,6R,7S)-N-(5,6-dichloro-3-pyridinyl)-3-methyl-7-pyridin-4-yl-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide.
| Compound Name | (1S,5R,6R,7S)-N-(5,6-dichloro-3-pyridinyl)-3-methyl-7-pyridin-4-yl-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide |
|---|---|
| PubChem CID | 166828991 |
| Molecular Formula | C19H17Cl2N3O2 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | (1S,5R,6R,7S)-N-(5,6-dichloro-3-pyridinyl)-3-methyl-7-pyridin-4-yl-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide |
| SMILES | CC1C2C1[C@@H]1O[C@H]2[C@H](C(=O)Nc2cnc(Cl)c(Cl)c2)[C@H]1c1ccncc1 |
| InChI | InChI=1S/C19H17Cl2N3O2/c1-8-12-13(8)17-15(14(16(12)26-17)9-2-4-22-5-3-9)19(25)24-10-6-11(20)18(21)23-7-10/h2-8,12-17H,1H3,(H,24,25)/t8?,12?,13?,14-,15-,16+,17-/m1/s1 |
| InChIKey | CEJYALRUXKMULW-YZLPKOKFSA-N |
| XLogP | 3.79 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|