C38H40O4Sn — CID 16683208
(Z)-3-[dibutyl-[(Z)-3-oxo-1,3-diphenylprop-1-enoxy]stannyl]oxy-1,3-diphenylprop-2-en-1-one (PubChem CID 16683208) has the molecular formula C38H40O4Sn and a molecular weight of 679.45 g/mol. Its IUPAC name is (Z)-3-[dibutyl-[(Z)-3-oxo-1,3-diphenylprop-1-enoxy]stannyl]oxy-1,3-diphenylprop-2-en-1-one.
| Compound Name | (Z)-3-[dibutyl-[(Z)-3-oxo-1,3-diphenylprop-1-enoxy]stannyl]oxy-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 16683208 |
| Molecular Formula | C38H40O4Sn |
| Molecular Weight | 679.45 g/mol |
| Exact Mass | 680.19 |
| IUPAC Name | (Z)-3-[dibutyl-[(Z)-3-oxo-1,3-diphenylprop-1-enoxy]stannyl]oxy-1,3-diphenylprop-2-en-1-one |
| SMILES | CCCC[Sn](CCCC)(O/C(=C\C(=O)c1ccccc1)c1ccccc1)O/C(=C\C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C15H12O2.2C4H9.Sn/c2*16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;2*1-3-4-2;/h2*1-11,16H;2*1,3-4H2,2H3;/q;;;;+2/p-2/b2*14-11-;;; |
| InChIKey | ZLSZWTRTSIVTTB-BGFMMZJESA-L |
| XLogP | 9.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.45 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|