C20H24FN — CID 166833469
(3E,6Z)-7-(4-fluoro-2-propan-2-ylphenyl)-4,6-dimethyl-2-methylideneocta-3,6-dienenitrile (PubChem CID 166833469) has the molecular formula C20H24FN and a molecular weight of 297.42 g/mol. Its IUPAC name is (3E,6Z)-7-(4-fluoro-2-propan-2-ylphenyl)-4,6-dimethyl-2-methylideneocta-3,6-dienenitrile.
| Compound Name | (3E,6Z)-7-(4-fluoro-2-propan-2-ylphenyl)-4,6-dimethyl-2-methylideneocta-3,6-dienenitrile |
|---|---|
| PubChem CID | 166833469 |
| Molecular Formula | C20H24FN |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | (3E,6Z)-7-(4-fluoro-2-propan-2-ylphenyl)-4,6-dimethyl-2-methylideneocta-3,6-dienenitrile |
| SMILES | C=C(C#N)/C=C(\C)C/C(C)=C(/C)c1ccc(F)cc1C(C)C |
| InChI | InChI=1S/C20H24FN/c1-13(2)20-11-18(21)7-8-19(20)17(6)16(5)10-14(3)9-15(4)12-22/h7-9,11,13H,4,10H2,1-3,5-6H3/b14-9+,17-16- |
| InChIKey | LVTDOBCXZNDKEC-ZFCMMHTMSA-N |
| XLogP | 6.16 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|