About triethylplumbyl 2-phenylquinoline-4-carboxylate
triethylplumbyl 2-phenylquinoline-4-carboxylate (PubChem CID 16683347) has the molecular formula C22H25NO2Pb
and a molecular weight of 542.65 g/mol. Its IUPAC name is triethylplumbyl 2-phenylquinoline-4-carboxylate.
Molecular Properties
| Compound Name | triethylplumbyl 2-phenylquinoline-4-carboxylate |
| PubChem CID | 16683347 |
| Molecular Formula | C22H25NO2Pb |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 543.17 |
| IUPAC Name | triethylplumbyl 2-phenylquinoline-4-carboxylate |
| SMILES | CC[Pb](CC)(CC)OC(=O)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C16H11NO2.3C2H5.Pb/c18-16(19)13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;3*1-2;/h1-10H,(H,18,19);3*1H2,2H3;/q;;;;+1/p-1 |
| InChIKey | YQAXVIWHHZPOCF-UHFFFAOYSA-M |
| XLogP | 6.06 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze triethylplumbyl 2-phenylquinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethylplumbyl 2-phenylquinoline-4-carboxylate?
The IUPAC name of triethylplumbyl 2-phenylquinoline-4-carboxylate (CID 16683347) is triethylplumbyl 2-phenylquinoline-4-carboxylate.
What is the SMILES notation for triethylplumbyl 2-phenylquinoline-4-carboxylate?
The canonical SMILES for triethylplumbyl 2-phenylquinoline-4-carboxylate is CC[Pb](CC)(CC)OC(=O)c1cc(-c2ccccc2)nc2ccccc12.
What is the InChIKey of triethylplumbyl 2-phenylquinoline-4-carboxylate?
The InChIKey is YQAXVIWHHZPOCF-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H11NO2.3C2H5.Pb/c18-16(19)13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;3*1-2;/h1-10H,(H,18,19);3*1H2,2H3;/q;;;;+1/p-1.
What are the key properties of triethylplumbyl 2-phenylquinoline-4-carboxylate?
triethylplumbyl 2-phenylquinoline-4-carboxylate has a molecular weight of 542.65 g/mol, XLogP of 6.06, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethylplumbyl 2-phenylquinoline-4-carboxylate is sourced from PubChem (CID 16683347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).