C22H24N4O4 — CID 166835963
5-(2-hydroxypyrrolidin-1-yl)-8,14-dioxa-10,19,20-triazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18(21)-heptaen-9-one (PubChem CID 166835963) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 5-(2-hydroxypyrrolidin-1-yl)-8,14-dioxa-10,19,20-triazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18(21)-heptaen-9-one.
| Compound Name | 5-(2-hydroxypyrrolidin-1-yl)-8,14-dioxa-10,19,20-triazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18(21)-heptaen-9-one |
|---|---|
| PubChem CID | 166835963 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 5-(2-hydroxypyrrolidin-1-yl)-8,14-dioxa-10,19,20-triazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18(21)-heptaen-9-one |
| SMILES | O=C1NCCCOc2ccc3[nH]nc(c3c2)-c2ccc(N3CCCC3O)c(c2)CO1 |
| InChI | InChI=1S/C22H24N4O4/c27-20-3-1-9-26(20)19-7-4-14-11-15(19)13-30-22(28)23-8-2-10-29-16-5-6-18-17(12-16)21(14)25-24-18/h4-7,11-12,20,27H,1-3,8-10,13H2,(H,23,28)(H,24,25) |
| InChIKey | MCXTZQXXHSBVJZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 99.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |