C18H20N4O3 — CID 170698440
(9S,13S)-9,13-dimethyl-7,10,14-trioxa-5,19,20,23-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18(21)-heptaene (PubChem CID 170698440) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is (9S,13S)-9,13-dimethyl-7,10,14-trioxa-5,19,20,23-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18(21)-heptaene.
| Compound Name | (9S,13S)-9,13-dimethyl-7,10,14-trioxa-5,19,20,23-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18(21)-heptaene |
|---|---|
| PubChem CID | 170698440 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (9S,13S)-9,13-dimethyl-7,10,14-trioxa-5,19,20,23-tetrazatetracyclo[13.5.2.12,6.018,21]tricosa-1(20),2(23),3,5,15(22),16,18(21)-heptaene |
| SMILES | C[C@H]1COc2nccc(n2)-c2n[nH]c3ccc(cc23)O[C@@H](C)CCO1 |
| InChI | InChI=1S/C18H20N4O3/c1-11-6-8-23-12(2)10-24-18-19-7-5-16(20-18)17-14-9-13(25-11)3-4-15(14)21-22-17/h3-5,7,9,11-12H,6,8,10H2,1-2H3,(H,21,22)/t11-,12-/m0/s1 |
| InChIKey | SSEOHCSKOLSIDK-RYUDHWBXSA-N |
| XLogP | 2.97 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |