C19H20N4O3 — CID 170698474
(12R)-12-methyl-8,11,14-trioxa-5,19,20-triazatetracyclo[13.5.2.12,5.018,21]tricosa-1(20),2(23),3,15(22),16,18(21)-hexaene-4-carbonitrile (PubChem CID 170698474) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is (12R)-12-methyl-8,11,14-trioxa-5,19,20-triazatetracyclo[13.5.2.12,5.018,21]tricosa-1(20),2(23),3,15(22),16,18(21)-hexaene-4-carbonitrile.
| Compound Name | (12R)-12-methyl-8,11,14-trioxa-5,19,20-triazatetracyclo[13.5.2.12,5.018,21]tricosa-1(20),2(23),3,15(22),16,18(21)-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 170698474 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (12R)-12-methyl-8,11,14-trioxa-5,19,20-triazatetracyclo[13.5.2.12,5.018,21]tricosa-1(20),2(23),3,15(22),16,18(21)-hexaene-4-carbonitrile |
| SMILES | C[C@@H]1COc2ccc3[nH]nc(c3c2)-c2cc(C#N)n(c2)CCOCCO1 |
| InChI | InChI=1S/C19H20N4O3/c1-13-12-26-16-2-3-18-17(9-16)19(22-21-18)14-8-15(10-20)23(11-14)4-5-24-6-7-25-13/h2-3,8-9,11,13H,4-7,12H2,1H3,(H,21,22)/t13-/m1/s1 |
| InChIKey | PHKZQZMGAYWGPQ-CYBMUJFWSA-N |
| XLogP | 2.72 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |