C22H17Br4O4Sb — CID 16683779
[(2,2-dibromoacetyl)oxy-triphenyl-λ5-stibanyl] 2,2-dibromoacetate (PubChem CID 16683779) has the molecular formula C22H17Br4O4Sb and a molecular weight of 786.75 g/mol. Its IUPAC name is [(2,2-dibromoacetyl)oxy-triphenyl-λ5-stibanyl] 2,2-dibromoacetate.
| Compound Name | [(2,2-dibromoacetyl)oxy-triphenyl-λ5-stibanyl] 2,2-dibromoacetate |
|---|---|
| PubChem CID | 16683779 |
| Molecular Formula | C22H17Br4O4Sb |
| Molecular Weight | 786.75 g/mol |
| Exact Mass | 781.69 |
| IUPAC Name | [(2,2-dibromoacetyl)oxy-triphenyl-λ5-stibanyl] 2,2-dibromoacetate |
| SMILES | O=C(O[Sb](OC(=O)C(Br)Br)(c1ccccc1)(c1ccccc1)c1ccccc1)C(Br)Br |
| InChI | InChI=1S/3C6H5.2C2H2Br2O2.Sb/c3*1-2-4-6-5-3-1;2*3-1(4)2(5)6;/h3*1-5H;2*1H,(H,5,6);/q;;;;;+2/p-2 |
| InChIKey | GRQPZJFILGOLTJ-UHFFFAOYSA-L |
| XLogP | 4.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.75 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|