C14H15Br2NO2 — CID 162508145
(5-phenyl-2-azabicyclo[2.2.1]heptan-5-yl) 2,2-dibromoacetate (PubChem CID 162508145) has the molecular formula C14H15Br2NO2 and a molecular weight of 389.09 g/mol. Its IUPAC name is (5-phenyl-2-azabicyclo[2.2.1]heptan-5-yl) 2,2-dibromoacetate.
| Compound Name | (5-phenyl-2-azabicyclo[2.2.1]heptan-5-yl) 2,2-dibromoacetate |
|---|---|
| PubChem CID | 162508145 |
| Molecular Formula | C14H15Br2NO2 |
| Molecular Weight | 389.09 g/mol |
| Exact Mass | 386.95 |
| IUPAC Name | (5-phenyl-2-azabicyclo[2.2.1]heptan-5-yl) 2,2-dibromoacetate |
| SMILES | O=C(OC1(c2ccccc2)CC2CC1CN2)C(Br)Br |
| InChI | InChI=1S/C14H15Br2NO2/c15-12(16)13(18)19-14(9-4-2-1-3-5-9)7-11-6-10(14)8-17-11/h1-5,10-12,17H,6-8H2 |
| InChIKey | CKLDGGVECVVNNX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.09 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|