C10H10O10 — CID 166844283
2-oxo-2-[(4,5,10-trihydroxy-8-oxo-7,9-dioxatricyclo[4.3.1.02,5]decan-3-yl)oxy]acetic acid (PubChem CID 166844283) has the molecular formula C10H10O10 and a molecular weight of 290.18 g/mol. Its IUPAC name is 2-oxo-2-[(4,5,10-trihydroxy-8-oxo-7,9-dioxatricyclo[4.3.1.02,5]decan-3-yl)oxy]acetic acid.
| Compound Name | 2-oxo-2-[(4,5,10-trihydroxy-8-oxo-7,9-dioxatricyclo[4.3.1.02,5]decan-3-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 166844283 |
| Molecular Formula | C10H10O10 |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 2-oxo-2-[(4,5,10-trihydroxy-8-oxo-7,9-dioxatricyclo[4.3.1.02,5]decan-3-yl)oxy]acetic acid |
| SMILES | O=C1OC2C(O)C(O1)C1(O)C(O)C(OC(=O)C(=O)O)C21 |
| InChI | InChI=1S/C10H10O10/c11-2-3-1-4(18-8(15)7(13)14)5(12)10(1,17)6(2)20-9(16)19-3/h1-6,11-12,17H,(H,13,14) |
| InChIKey | RZVXLWCPUOHUPA-UHFFFAOYSA-N |
| XLogP | -3.02 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|