About 2-oxatricyclo[4.3.0.03,7]non-1(9)-ene-4,5,6,8-tetrol
2-oxatricyclo[4.3.0.03,7]non-1(9)-ene-4,5,6,8-tetrol (PubChem CID 130961761) has the molecular formula C8H10O5
and a molecular weight of 186.16 g/mol. Its IUPAC name is 2-oxatricyclo[4.3.0.03,7]non-1(9)-ene-4,5,6,8-tetrol.
Analyze 2-oxatricyclo[4.3.0.03,7]non-1(9)-ene-4,5,6,8-tetrol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxatricyclo[4.3.0.03,7]non-1(9)-ene-4,5,6,8-tetrol?
The IUPAC name of 2-oxatricyclo[4.3.0.03,7]non-1(9)-ene-4,5,6,8-tetrol (CID 130961761) is 2-oxatricyclo[4.3.0.03,7]non-1(9)-ene-4,5,6,8-tetrol.
What is the SMILES notation for 2-oxatricyclo[4.3.0.03,7]non-1(9)-ene-4,5,6,8-tetrol?
The canonical SMILES for 2-oxatricyclo[4.3.0.03,7]non-1(9)-ene-4,5,6,8-tetrol is OC1C=C2OC3C(O)C(O)C2(O)C13.
What is the InChIKey of 2-oxatricyclo[4.3.0.03,7]non-1(9)-ene-4,5,6,8-tetrol?
The InChIKey is MOENKPKMZWTCDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O5/c9-2-1-3-8(12)4(2)6(13-3)5(10)7(8)11/h1-2,4-7,9-12H.
What are the key properties of 2-oxatricyclo[4.3.0.03,7]non-1(9)-ene-4,5,6,8-tetrol?
2-oxatricyclo[4.3.0.03,7]non-1(9)-ene-4,5,6,8-tetrol has a molecular weight of 186.16 g/mol, XLogP of -2.27, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxatricyclo[4.3.0.03,7]non-1(9)-ene-4,5,6,8-tetrol is sourced from PubChem (CID 130961761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).