C10H21N3O — CID 166845470
5-imino-1-methyl-3,4-di(propan-2-yl)imidazolidin-2-ol (PubChem CID 166845470) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 5-imino-1-methyl-3,4-di(propan-2-yl)imidazolidin-2-ol.
| Compound Name | 5-imino-1-methyl-3,4-di(propan-2-yl)imidazolidin-2-ol |
|---|---|
| PubChem CID | 166845470 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 5-imino-1-methyl-3,4-di(propan-2-yl)imidazolidin-2-ol |
| SMILES | [H]/N=C1/C(C(C)C)N(C(C)C)C(O)N1C |
| InChI | InChI=1S/C10H21N3O/c1-6(2)8-9(11)12(5)10(14)13(8)7(3)4/h6-8,10-11,14H,1-5H3/b11-9- |
| InChIKey | HJODHXPAQDBTNF-LUAWRHEFSA-N |
| XLogP | 0.92 |
| TPSA | 50.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|