C12H16FNO — CID 166845587
(3R)-3-ethyl-5-fluoro-3,3a-dimethyl-1,7a-dihydroindol-2-one (PubChem CID 166845587) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is (3R)-3-ethyl-5-fluoro-3,3a-dimethyl-1,7a-dihydroindol-2-one.
| Compound Name | (3R)-3-ethyl-5-fluoro-3,3a-dimethyl-1,7a-dihydroindol-2-one |
|---|---|
| PubChem CID | 166845587 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (3R)-3-ethyl-5-fluoro-3,3a-dimethyl-1,7a-dihydroindol-2-one |
| SMILES | CC[C@@]1(C)C(=O)NC2C=CC(F)=CC21C |
| InChI | InChI=1S/C12H16FNO/c1-4-11(2)10(15)14-9-6-5-8(13)7-12(9,11)3/h5-7,9H,4H2,1-3H3,(H,14,15)/t9?,11-,12?/m0/s1 |
| InChIKey | GHUNRWCQHLKUSV-ZYXZCXLHSA-N |
| XLogP | 2.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |