C11H21NOS — CID 121218229
2,2,5,5-tetraethyl-1,3-thiazolidin-4-one (PubChem CID 121218229) has the molecular formula C11H21NOS and a molecular weight of 215.36 g/mol. Its IUPAC name is 2,2,5,5-tetraethyl-1,3-thiazolidin-4-one.
| Compound Name | 2,2,5,5-tetraethyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 121218229 |
| Molecular Formula | C11H21NOS |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2,2,5,5-tetraethyl-1,3-thiazolidin-4-one |
| SMILES | CCC1(CC)NC(=O)C(CC)(CC)S1 |
| InChI | InChI=1S/C11H21NOS/c1-5-10(6-2)9(13)12-11(7-3,8-4)14-10/h5-8H2,1-4H3,(H,12,13) |
| InChIKey | GAEZQFNHHLFWLU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |