C13H23N3OS — CID 136630696
2-(azepan-1-ylimino)-5,5-diethyl-1,3-thiazolidin-4-one (PubChem CID 136630696) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is 2-(azepan-1-ylimino)-5,5-diethyl-1,3-thiazolidin-4-one.
| Compound Name | 2-(azepan-1-ylimino)-5,5-diethyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136630696 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-(azepan-1-ylimino)-5,5-diethyl-1,3-thiazolidin-4-one |
| SMILES | CCC1(CC)SC(=NN2CCCCCC2)NC1=O |
| InChI | InChI=1S/C13H23N3OS/c1-3-13(4-2)11(17)14-12(18-13)15-16-9-7-5-6-8-10-16/h3-10H2,1-2H3,(H,14,15,17) |
| InChIKey | HSKJYRWLPMTLSI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|