C32H40O8 — CID 45053186
(4Z,9Z,14Z,19Z)-2,7,12,17-tetraethyl-2,7,12,17-tetramethylcycloicosa-4,9,14,19-tetraene-1,3,6,8,11,13,16,18-octone (PubChem CID 45053186) has the molecular formula C32H40O8 and a molecular weight of 552.66 g/mol. Its IUPAC name is (4Z,9Z,14Z,19Z)-2,7,12,17-tetraethyl-2,7,12,17-tetramethylcycloicosa-4,9,14,19-tetraene-1,3,6,8,11,13,16,18-octone.
| Compound Name | (4Z,9Z,14Z,19Z)-2,7,12,17-tetraethyl-2,7,12,17-tetramethylcycloicosa-4,9,14,19-tetraene-1,3,6,8,11,13,16,18-octone |
|---|---|
| PubChem CID | 45053186 |
| Molecular Formula | C32H40O8 |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | (4Z,9Z,14Z,19Z)-2,7,12,17-tetraethyl-2,7,12,17-tetramethylcycloicosa-4,9,14,19-tetraene-1,3,6,8,11,13,16,18-octone |
| SMILES | CCC1(C)C(=O)/C=C\C(=O)C(C)(CC)C(=O)/C=C\C(=O)C(C)(CC)C(=O)/C=C\C(=O)C(C)(CC)C(=O)/C=C\C1=O |
| InChI | InChI=1S/C32H40O8/c1-9-29(5)21(33)13-15-23(35)30(6,10-2)25(37)17-19-27(39)32(8,12-4)28(40)20-18-26(38)31(7,11-3)24(36)16-14-22(29)34/h13-20H,9-12H2,1-8H3/b15-13-,16-14-,19-17-,20-18- |
| InChIKey | GICCVQVEMBWCKG-WLYXFYDPSA-N |
| XLogP | 4.44 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|