C11H15N5O — CID 166850885
4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide (PubChem CID 166850885) has the molecular formula C11H15N5O and a molecular weight of 233.28 g/mol. Its IUPAC name is 4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide.
| Compound Name | 4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 166850885 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(/C(N)=N/N=C\N)cc1C |
| InChI | InChI=1S/C11H15N5O/c1-7-5-8(10(13)16-15-6-12)3-4-9(7)11(17)14-2/h3-6H,1-2H3,(H2,12,15)(H2,13,16)(H,14,17) |
| InChIKey | KPQTZHYFGMZAKF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|