About 4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide
4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide (PubChem CID 166850885) has the molecular formula C11H15N5O
and a molecular weight of 233.28 g/mol. Its IUPAC name is 4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide |
| PubChem CID | 166850885 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(/C(N)=N/N=C\N)cc1C |
| InChI | InChI=1S/C11H15N5O/c1-7-5-8(10(13)16-15-6-12)3-4-9(7)11(17)14-2/h3-6H,1-2H3,(H2,12,15)(H2,13,16)(H,14,17) |
| InChIKey | KPQTZHYFGMZAKF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide?
The IUPAC name of 4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide (CID 166850885) is 4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide.
What is the SMILES notation for 4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide?
The canonical SMILES for 4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide is CNC(=O)c1ccc(/C(N)=N/N=C\N)cc1C.
What is the InChIKey of 4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide?
The InChIKey is KPQTZHYFGMZAKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5O/c1-7-5-8(10(13)16-15-6-12)3-4-9(7)11(17)14-2/h3-6H,1-2H3,(H2,12,15)(H2,13,16)(H,14,17).
What are the key properties of 4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide?
4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide has a molecular weight of 233.28 g/mol, XLogP of -0.04, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-N'-[(Z)-aminomethylideneamino]carbamimidoyl]-N,2-dimethylbenzamide is sourced from PubChem (CID 166850885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).