C20H28F2N2O2 — CID 166854235
1-[3-amino-2-[[4-fluoro-4-(3-fluorophenyl)cyclohexyl]oxymethyl]piperidin-1-yl]ethanone (PubChem CID 166854235) has the molecular formula C20H28F2N2O2 and a molecular weight of 366.45 g/mol. Its IUPAC name is 1-[3-amino-2-[[4-fluoro-4-(3-fluorophenyl)cyclohexyl]oxymethyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[3-amino-2-[[4-fluoro-4-(3-fluorophenyl)cyclohexyl]oxymethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 166854235 |
| Molecular Formula | C20H28F2N2O2 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 1-[3-amino-2-[[4-fluoro-4-(3-fluorophenyl)cyclohexyl]oxymethyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC(N)C1COC1CCC(F)(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C20H28F2N2O2/c1-14(25)24-11-3-6-18(23)19(24)13-26-17-7-9-20(22,10-8-17)15-4-2-5-16(21)12-15/h2,4-5,12,17-19H,3,6-11,13,23H2,1H3 |
| InChIKey | JVAWFLWUWJMRQV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |