C20H25F2N7O2 — CID 166855409
N-[(10S)-2,6-diamino-10-hydroxy-10-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-7,7-difluoro-6,8-dihydro-5H-naphthalene-1-carboxamide (PubChem CID 166855409) has the molecular formula C20H25F2N7O2 and a molecular weight of 433.46 g/mol. Its IUPAC name is N-[(10S)-2,6-diamino-10-hydroxy-10-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-7,7-difluoro-6,8-dihydro-5H-naphthalene-1-carboxamide.
| Compound Name | N-[(10S)-2,6-diamino-10-hydroxy-10-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-7,7-difluoro-6,8-dihydro-5H-naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 166855409 |
| Molecular Formula | C20H25F2N7O2 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-[(10S)-2,6-diamino-10-hydroxy-10-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]-7,7-difluoro-6,8-dihydro-5H-naphthalene-1-carboxamide |
| SMILES | C[C@]1(O)C(NC(=O)c2cccc3c2CC(F)(F)CC3)CN2C(N)=NCC3N=C(N)NC321 |
| InChI | InChI=1S/C20H25F2N7O2/c1-18(31)14(9-29-17(24)25-8-13-20(18,29)28-16(23)27-13)26-15(30)11-4-2-3-10-5-6-19(21,22)7-12(10)11/h2-4,13-14,31H,5-9H2,1H3,(H2,24,25)(H,26,30)(H3,23,27,28)/t13?,14?,18-,20?/m0/s1 |
| InChIKey | FKOIAOUSJIWZKA-JZTRIWFXSA-N |
| XLogP | -0.71 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |