C23H35N7O3 — CID 166717460
3,5-ditert-butyl-N-[(9S)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]benzamide (PubChem CID 166717460) has the molecular formula C23H35N7O3 and a molecular weight of 457.58 g/mol. Its IUPAC name is 3,5-ditert-butyl-N-[(9S)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]benzamide.
| Compound Name | 3,5-ditert-butyl-N-[(9S)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]benzamide |
|---|---|
| PubChem CID | 166717460 |
| Molecular Formula | C23H35N7O3 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | 3,5-ditert-butyl-N-[(9S)-2,6-diamino-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl]benzamide |
| SMILES | CC(C)(C)c1cc(C(=O)N[C@H]2CN3C(N)=NCC4N=C(N)NC43C2(O)O)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H35N7O3/c1-20(2,3)13-7-12(8-14(9-13)21(4,5)6)17(31)27-16-11-30-19(25)26-10-15-22(30,23(16,32)33)29-18(24)28-15/h7-9,15-16,32-33H,10-11H2,1-6H3,(H2,25,26)(H,27,31)(H3,24,28,29)/t15?,16-,22?/m0/s1 |
| InChIKey | PWLPIHITUJZVTF-BXFSZVDSSA-N |
| XLogP | -0.31 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|