About CID 16686376
CID 16686376 (PubChem CID 16686376) has the molecular formula C22H32FeP2+2
and a molecular weight of 414.29 g/mol.
Molecular Properties
| Compound Name | CID 16686376 |
| PubChem CID | 16686376 |
| Molecular Formula | C22H32FeP2+2 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][CH][C](PC2CCCCC2)[CH]1.[CH]1[CH][CH][C](PC2CCCCC2)[CH]1.[Fe+2] |
| InChI | InChI=1S/2C11H16P.Fe/c2*1-2-6-10(7-3-1)12-11-8-4-5-9-11;/h2*4-5,8-10,12H,1-3,6-7H2;/q;;+2 |
| InChIKey | HNEQGMRJNWGAGM-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 16686376 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 16686376?
The IUPAC name of CID 16686376 (CID 16686376) is not available.
What is the SMILES notation for CID 16686376?
The canonical SMILES for CID 16686376 is [CH]1[CH][CH][C](PC2CCCCC2)[CH]1.[CH]1[CH][CH][C](PC2CCCCC2)[CH]1.[Fe+2].
What is the InChIKey of CID 16686376?
The InChIKey is HNEQGMRJNWGAGM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H16P.Fe/c2*1-2-6-10(7-3-1)12-11-8-4-5-9-11;/h2*4-5,8-10,12H,1-3,6-7H2;/q;;+2.
What are the key properties of CID 16686376?
CID 16686376 has a molecular weight of 414.29 g/mol, XLogP of 6.72, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 16686376 is sourced from PubChem (CID 16686376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).