C41H39N3O — CID 166864716
2-cyclohexa-2,4-dien-1-yl-6-[(2Z,4E)-4-cyclohexa-1,3-dien-1-ylhepta-2,4-dienyl]-4-(4-dibenzofuran-3-ylphenyl)-4-methyl-1H-1,3,5-triazine (PubChem CID 166864716) has the molecular formula C41H39N3O and a molecular weight of 589.78 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-6-[(2Z,4E)-4-cyclohexa-1,3-dien-1-ylhepta-2,4-dienyl]-4-(4-dibenzofuran-3-ylphenyl)-4-methyl-1H-1,3,5-triazine.
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-6-[(2Z,4E)-4-cyclohexa-1,3-dien-1-ylhepta-2,4-dienyl]-4-(4-dibenzofuran-3-ylphenyl)-4-methyl-1H-1,3,5-triazine |
|---|---|
| PubChem CID | 166864716 |
| Molecular Formula | C41H39N3O |
| Molecular Weight | 589.78 g/mol |
| Exact Mass | 589.31 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-6-[(2Z,4E)-4-cyclohexa-1,3-dien-1-ylhepta-2,4-dienyl]-4-(4-dibenzofuran-3-ylphenyl)-4-methyl-1H-1,3,5-triazine |
| SMILES | CC/C=C(\C=C/CC1=NC(C)(c2ccc(-c3ccc4c(c3)oc3ccccc34)cc2)N=C(C2C=CC=CC2)N1)C1=CC=CCC1 |
| InChI | InChI=1S/C41H39N3O/c1-3-13-29(30-14-6-4-7-15-30)18-12-21-39-42-40(32-16-8-5-9-17-32)44-41(2,43-39)34-25-22-31(23-26-34)33-24-27-36-35-19-10-11-20-37(35)45-38(36)28-33/h4-6,8-14,16,18-20,22-28,32H,3,7,15,17,21H2,1-2H3,(H,42,43,44)/b18-12-,29-13+ |
| InChIKey | PIWDQDDNPLJSTF-QRCKZWJJSA-N |
| XLogP | 10.52 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.78 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|