C18H26N2O2 — CID 166865359
N-buta-1,3-dien-2-yloxy-5-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]-N-methylhex-5-enamide (PubChem CID 166865359) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yloxy-5-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]-N-methylhex-5-enamide.
| Compound Name | N-buta-1,3-dien-2-yloxy-5-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]-N-methylhex-5-enamide |
|---|---|
| PubChem CID | 166865359 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N-buta-1,3-dien-2-yloxy-5-[(2,5-dimethylidenepyrrolidin-1-yl)methyl]-N-methylhex-5-enamide |
| SMILES | C=CC(=C)ON(C)C(=O)CCCC(=C)CN1C(=C)CCC1=C |
| InChI | InChI=1S/C18H26N2O2/c1-7-17(5)22-19(6)18(21)10-8-9-14(2)13-20-15(3)11-12-16(20)4/h7H,1-5,8-13H2,6H3 |
| InChIKey | LGKCITMLYNKKDS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|