About N'-ethenyl-N'-propan-2-ylpentanediamide
N'-ethenyl-N'-propan-2-ylpentanediamide (PubChem CID 59324613) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is N'-ethenyl-N'-propan-2-ylpentanediamide.
Molecular Properties
| Compound Name | N'-ethenyl-N'-propan-2-ylpentanediamide |
| PubChem CID | 59324613 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | N'-ethenyl-N'-propan-2-ylpentanediamide |
| SMILES | C=CN(C(=O)CCCC(N)=O)C(C)C |
| InChI | InChI=1S/C10H18N2O2/c1-4-12(8(2)3)10(14)7-5-6-9(11)13/h4,8H,1,5-7H2,2-3H3,(H2,11,13) |
| InChIKey | JJOKSIWYXSOZBO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-ethenyl-N'-propan-2-ylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethenyl-N'-propan-2-ylpentanediamide?
The IUPAC name of N'-ethenyl-N'-propan-2-ylpentanediamide (CID 59324613) is N'-ethenyl-N'-propan-2-ylpentanediamide.
What is the SMILES notation for N'-ethenyl-N'-propan-2-ylpentanediamide?
The canonical SMILES for N'-ethenyl-N'-propan-2-ylpentanediamide is C=CN(C(=O)CCCC(N)=O)C(C)C.
What is the InChIKey of N'-ethenyl-N'-propan-2-ylpentanediamide?
The InChIKey is JJOKSIWYXSOZBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-4-12(8(2)3)10(14)7-5-6-9(11)13/h4,8H,1,5-7H2,2-3H3,(H2,11,13).
What are the key properties of N'-ethenyl-N'-propan-2-ylpentanediamide?
N'-ethenyl-N'-propan-2-ylpentanediamide has a molecular weight of 198.27 g/mol, XLogP of 1.02, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethenyl-N'-propan-2-ylpentanediamide is sourced from PubChem (CID 59324613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).