C21H43N — CID 166865927
N-[(3E)-3-ethylidene-4,4-dimethylhexan-2-yl]-6,7-dimethylnonan-3-amine (PubChem CID 166865927) has the molecular formula C21H43N and a molecular weight of 309.58 g/mol. Its IUPAC name is N-[(3E)-3-ethylidene-4,4-dimethylhexan-2-yl]-6,7-dimethylnonan-3-amine.
| Compound Name | N-[(3E)-3-ethylidene-4,4-dimethylhexan-2-yl]-6,7-dimethylnonan-3-amine |
|---|---|
| PubChem CID | 166865927 |
| Molecular Formula | C21H43N |
| Molecular Weight | 309.58 g/mol |
| Exact Mass | 309.34 |
| IUPAC Name | N-[(3E)-3-ethylidene-4,4-dimethylhexan-2-yl]-6,7-dimethylnonan-3-amine |
| SMILES | C/C=C(/C(C)NC(CC)CCC(C)C(C)CC)C(C)(C)CC |
| InChI | InChI=1S/C21H43N/c1-10-16(5)17(6)14-15-19(11-2)22-18(7)20(12-3)21(8,9)13-4/h12,16-19,22H,10-11,13-15H2,1-9H3/b20-12- |
| InChIKey | GBVOYBKTMZZBNB-NDENLUEZSA-N |
| XLogP | 6.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.58 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|