C21H16ClFN2O3 — CID 166869444
5-[[(2-chlorophenyl)methyl-(3-fluorobenzoyl)amino]methyl]pyridine-2-carboxylic acid (PubChem CID 166869444) has the molecular formula C21H16ClFN2O3 and a molecular weight of 398.82 g/mol. Its IUPAC name is 5-[[(2-chlorophenyl)methyl-(3-fluorobenzoyl)amino]methyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[[(2-chlorophenyl)methyl-(3-fluorobenzoyl)amino]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 166869444 |
| Molecular Formula | C21H16ClFN2O3 |
| Molecular Weight | 398.82 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 5-[[(2-chlorophenyl)methyl-(3-fluorobenzoyl)amino]methyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CN(Cc2ccccc2Cl)C(=O)c2cccc(F)c2)cn1 |
| InChI | InChI=1S/C21H16ClFN2O3/c22-18-7-2-1-4-16(18)13-25(20(26)15-5-3-6-17(23)10-15)12-14-8-9-19(21(27)28)24-11-14/h1-11H,12-13H2,(H,27,28) |
| InChIKey | QULFDRLLSQQACQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.82 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |