C23H26F2N4O2 — CID 166870419
(11R)-4-[(2S)-2,4-dimethylpyrrolidin-1-yl]-7-fluoro-6-(2-fluorophenyl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one (PubChem CID 166870419) has the molecular formula C23H26F2N4O2 and a molecular weight of 428.48 g/mol. Its IUPAC name is (11R)-4-[(2S)-2,4-dimethylpyrrolidin-1-yl]-7-fluoro-6-(2-fluorophenyl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one.
| Compound Name | (11R)-4-[(2S)-2,4-dimethylpyrrolidin-1-yl]-7-fluoro-6-(2-fluorophenyl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
|---|---|
| PubChem CID | 166870419 |
| Molecular Formula | C23H26F2N4O2 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | (11R)-4-[(2S)-2,4-dimethylpyrrolidin-1-yl]-7-fluoro-6-(2-fluorophenyl)-9-oxa-1,5,13-triazatricyclo[9.4.0.03,8]pentadeca-3(8),4,6-trien-2-one |
| SMILES | CC1C[C@H](C)N(c2nc(-c3ccccc3F)c(F)c3c2C(=O)N2CCNC[C@@H]2CO3)C1 |
| InChI | InChI=1S/C23H26F2N4O2/c1-13-9-14(2)29(11-13)22-18-21(31-12-15-10-26-7-8-28(15)23(18)30)19(25)20(27-22)16-5-3-4-6-17(16)24/h3-6,13-15,26H,7-12H2,1-2H3/t13?,14-,15+/m0/s1 |
| InChIKey | WXIQWJVKXKJXQP-NOYMGPGASA-N |
| XLogP | 3.07 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |