C5H7NS — CID 166872116
cis-(1R,2S)-1-ethenyl-2-thionitrosocyclopropane (PubChem CID 166872116) has the molecular formula C5H7NS and a molecular weight of 113.18 g/mol. Its IUPAC name is cis-(1R,2S)-1-ethenyl-2-thionitrosocyclopropane.
| Compound Name | cis-(1R,2S)-1-ethenyl-2-thionitrosocyclopropane |
|---|---|
| PubChem CID | 166872116 |
| Molecular Formula | C5H7NS |
| Molecular Weight | 113.18 g/mol |
| Exact Mass | 113.03 |
| IUPAC Name | cis-(1R,2S)-1-ethenyl-2-thionitrosocyclopropane |
| SMILES | C=C[C@H]1C[C@@H]1N=S |
| InChI | InChI=1S/C5H7NS/c1-2-4-3-5(4)6-7/h2,4-5H,1,3H2/t4-,5-/m0/s1 |
| InChIKey | ZVPOXCFQSFEESX-WHFBIAKZSA-N |
| XLogP | 1.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.18 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|