C18H11F4N5 — CID 166873909
6-fluoro-N-pyrimidin-2-yl-2-[4-(trifluoromethyl)phenyl]-1H-benzimidazol-5-amine (PubChem CID 166873909) has the molecular formula C18H11F4N5 and a molecular weight of 373.31 g/mol. Its IUPAC name is 6-fluoro-N-pyrimidin-2-yl-2-[4-(trifluoromethyl)phenyl]-1H-benzimidazol-5-amine.
| Compound Name | 6-fluoro-N-pyrimidin-2-yl-2-[4-(trifluoromethyl)phenyl]-1H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 166873909 |
| Molecular Formula | C18H11F4N5 |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 6-fluoro-N-pyrimidin-2-yl-2-[4-(trifluoromethyl)phenyl]-1H-benzimidazol-5-amine |
| SMILES | Fc1cc2[nH]c(-c3ccc(C(F)(F)F)cc3)nc2cc1Nc1ncccn1 |
| InChI | InChI=1S/C18H11F4N5/c19-12-8-14-15(9-13(12)27-17-23-6-1-7-24-17)26-16(25-14)10-2-4-11(5-3-10)18(20,21)22/h1-9H,(H,25,26)(H,23,24,27) |
| InChIKey | GRSHIYOKRURWCX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |