C18H12F3N5 — CID 168807090
N-pyrimidin-4-yl-2-[4-(trifluoromethyl)phenyl]-3H-benzimidazol-5-amine (PubChem CID 168807090) has the molecular formula C18H12F3N5 and a molecular weight of 355.32 g/mol. Its IUPAC name is N-pyrimidin-4-yl-2-[4-(trifluoromethyl)phenyl]-3H-benzimidazol-5-amine.
| Compound Name | N-pyrimidin-4-yl-2-[4-(trifluoromethyl)phenyl]-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 168807090 |
| Molecular Formula | C18H12F3N5 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-pyrimidin-4-yl-2-[4-(trifluoromethyl)phenyl]-3H-benzimidazol-5-amine |
| SMILES | FC(F)(F)c1ccc(-c2nc3ccc(Nc4ccncn4)cc3[nH]2)cc1 |
| InChI | InChI=1S/C18H12F3N5/c19-18(20,21)12-3-1-11(2-4-12)17-25-14-6-5-13(9-15(14)26-17)24-16-7-8-22-10-23-16/h1-10H,(H,25,26)(H,22,23,24) |
| InChIKey | SGOGTVBPBXJVNK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |