C24H31N4P — CID 166878360
(1Z)-1-(1-aminoethylidene)-N-(3-methyl-2-phosphanylphenyl)-7-(1,2,3,6-tetrahydropyridin-4-yl)-2,3,4,5-tetrahydro-2-benzazepin-5-amine (PubChem CID 166878360) has the molecular formula C24H31N4P and a molecular weight of 406.51 g/mol. Its IUPAC name is (1Z)-1-(1-aminoethylidene)-N-(3-methyl-2-phosphanylphenyl)-7-(1,2,3,6-tetrahydropyridin-4-yl)-2,3,4,5-tetrahydro-2-benzazepin-5-amine.
| Compound Name | (1Z)-1-(1-aminoethylidene)-N-(3-methyl-2-phosphanylphenyl)-7-(1,2,3,6-tetrahydropyridin-4-yl)-2,3,4,5-tetrahydro-2-benzazepin-5-amine |
|---|---|
| PubChem CID | 166878360 |
| Molecular Formula | C24H31N4P |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (1Z)-1-(1-aminoethylidene)-N-(3-methyl-2-phosphanylphenyl)-7-(1,2,3,6-tetrahydropyridin-4-yl)-2,3,4,5-tetrahydro-2-benzazepin-5-amine |
| SMILES | C/C(N)=C1/NCCC(Nc2cccc(C)c2P)c2cc(C3=CCNCC3)ccc21 |
| InChI | InChI=1S/C24H31N4P/c1-15-4-3-5-22(24(15)29)28-21-10-13-27-23(16(2)25)19-7-6-18(14-20(19)21)17-8-11-26-12-9-17/h3-8,14,21,26-28H,9-13,25,29H2,1-2H3/b23-16- |
| InChIKey | NESTVMHCFXBZQM-KQWNVCNZSA-N |
| XLogP | 3.67 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|