C4H4F4O3 — CID 166879287
(4R)-4-fluoro-5-(trifluoromethyl)-1,3-dioxolan-2-ol (PubChem CID 166879287) has the molecular formula C4H4F4O3 and a molecular weight of 176.06 g/mol. Its IUPAC name is (4R)-4-fluoro-5-(trifluoromethyl)-1,3-dioxolan-2-ol.
| Compound Name | (4R)-4-fluoro-5-(trifluoromethyl)-1,3-dioxolan-2-ol |
|---|---|
| PubChem CID | 166879287 |
| Molecular Formula | C4H4F4O3 |
| Molecular Weight | 176.06 g/mol |
| Exact Mass | 176.01 |
| IUPAC Name | (4R)-4-fluoro-5-(trifluoromethyl)-1,3-dioxolan-2-ol |
| SMILES | OC1OC(C(F)(F)F)[C@@H](F)O1 |
| InChI | InChI=1S/C4H4F4O3/c5-2-1(4(6,7)8)10-3(9)11-2/h1-3,9H/t1?,2-,3?/m0/s1 |
| InChIKey | CNZQVWHHYVEPNE-IBNSKMKBSA-N |
| XLogP | 0.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.06 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |