About oxobismuthanyl 2-hydroxy-5-nitrobenzoate
oxobismuthanyl 2-hydroxy-5-nitrobenzoate (PubChem CID 16688295) has the molecular formula C7H4BiNO6
and a molecular weight of 407.09 g/mol. Its IUPAC name is oxobismuthanyl 2-hydroxy-5-nitrobenzoate.
Molecular Properties
| Compound Name | oxobismuthanyl 2-hydroxy-5-nitrobenzoate |
| PubChem CID | 16688295 |
| Molecular Formula | C7H4BiNO6 |
| Molecular Weight | 407.09 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | oxobismuthanyl 2-hydroxy-5-nitrobenzoate |
| SMILES | O=[Bi]OC(=O)c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C7H5NO5.Bi.O/c9-6-2-1-4(8(12)13)3-5(6)7(10)11;;/h1-3,9H,(H,10,11);;/q;+1;/p-1 |
| InChIKey | IKOIPSLYBHBJGI-UHFFFAOYSA-M |
| XLogP | 0.42 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.09 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze oxobismuthanyl 2-hydroxy-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxobismuthanyl 2-hydroxy-5-nitrobenzoate?
The IUPAC name of oxobismuthanyl 2-hydroxy-5-nitrobenzoate (CID 16688295) is oxobismuthanyl 2-hydroxy-5-nitrobenzoate.
What is the SMILES notation for oxobismuthanyl 2-hydroxy-5-nitrobenzoate?
The canonical SMILES for oxobismuthanyl 2-hydroxy-5-nitrobenzoate is O=[Bi]OC(=O)c1cc([N+](=O)[O-])ccc1O.
What is the InChIKey of oxobismuthanyl 2-hydroxy-5-nitrobenzoate?
The InChIKey is IKOIPSLYBHBJGI-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5NO5.Bi.O/c9-6-2-1-4(8(12)13)3-5(6)7(10)11;;/h1-3,9H,(H,10,11);;/q;+1;/p-1.
What are the key properties of oxobismuthanyl 2-hydroxy-5-nitrobenzoate?
oxobismuthanyl 2-hydroxy-5-nitrobenzoate has a molecular weight of 407.09 g/mol, XLogP of 0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxobismuthanyl 2-hydroxy-5-nitrobenzoate is sourced from PubChem (CID 16688295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).