C16H27FO6S — CID 166885295
2-fluoro-4-[3-(1-hydroxy-3-bicyclo[3.3.1]nonanyl)propanoyloxy]butane-1-sulfonic acid (PubChem CID 166885295) has the molecular formula C16H27FO6S and a molecular weight of 366.45 g/mol. Its IUPAC name is 2-fluoro-4-[3-(1-hydroxy-3-bicyclo[3.3.1]nonanyl)propanoyloxy]butane-1-sulfonic acid.
| Compound Name | 2-fluoro-4-[3-(1-hydroxy-3-bicyclo[3.3.1]nonanyl)propanoyloxy]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 166885295 |
| Molecular Formula | C16H27FO6S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-fluoro-4-[3-(1-hydroxy-3-bicyclo[3.3.1]nonanyl)propanoyloxy]butane-1-sulfonic acid |
| SMILES | O=C(CCC1CC2CCCC(O)(C2)C1)OCCC(F)CS(=O)(=O)O |
| InChI | InChI=1S/C16H27FO6S/c17-14(11-24(20,21)22)5-7-23-15(18)4-3-13-8-12-2-1-6-16(19,9-12)10-13/h12-14,19H,1-11H2,(H,20,21,22) |
| InChIKey | YKBYLIRPXSWUOC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|