C21H23N3O5 — CID 166887063
ethyl 4-(3-butoxy-1,2-benzoxazol-6-yl)-2,3-dihydropyrido[3,2-b][1,4]oxazine-7-carboxylate (PubChem CID 166887063) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is ethyl 4-(3-butoxy-1,2-benzoxazol-6-yl)-2,3-dihydropyrido[3,2-b][1,4]oxazine-7-carboxylate.
| Compound Name | ethyl 4-(3-butoxy-1,2-benzoxazol-6-yl)-2,3-dihydropyrido[3,2-b][1,4]oxazine-7-carboxylate |
|---|---|
| PubChem CID | 166887063 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | ethyl 4-(3-butoxy-1,2-benzoxazol-6-yl)-2,3-dihydropyrido[3,2-b][1,4]oxazine-7-carboxylate |
| SMILES | CCCCOc1noc2cc(N3CCOc4cc(C(=O)OCC)cnc43)ccc12 |
| InChI | InChI=1S/C21H23N3O5/c1-3-5-9-28-20-16-7-6-15(12-17(16)29-23-20)24-8-10-27-18-11-14(13-22-19(18)24)21(25)26-4-2/h6-7,11-13H,3-5,8-10H2,1-2H3 |
| InChIKey | ILSVTKYCNRISKT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 86.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|