C12H10ClNO2S2 — CID 166887620
ethyl 5-(4-chlorophenyl)sulfanyl-1,3-thiazole-4-carboxylate (PubChem CID 166887620) has the molecular formula C12H10ClNO2S2 and a molecular weight of 299.80 g/mol. Its IUPAC name is ethyl 5-(4-chlorophenyl)sulfanyl-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-(4-chlorophenyl)sulfanyl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 166887620 |
| Molecular Formula | C12H10ClNO2S2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | ethyl 5-(4-chlorophenyl)sulfanyl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncsc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H10ClNO2S2/c1-2-16-11(15)10-12(17-7-14-10)18-9-5-3-8(13)4-6-9/h3-7H,2H2,1H3 |
| InChIKey | MVZAHQZQTNDEGF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |