C22H39N — CID 166889637
(6E,12E,15E)-N-methylhenicosa-1,6,12,15-tetraen-2-amine (PubChem CID 166889637) has the molecular formula C22H39N and a molecular weight of 317.56 g/mol. Its IUPAC name is (6E,12E,15E)-N-methylhenicosa-1,6,12,15-tetraen-2-amine.
| Compound Name | (6E,12E,15E)-N-methylhenicosa-1,6,12,15-tetraen-2-amine |
|---|---|
| PubChem CID | 166889637 |
| Molecular Formula | C22H39N |
| Molecular Weight | 317.56 g/mol |
| Exact Mass | 317.31 |
| IUPAC Name | (6E,12E,15E)-N-methylhenicosa-1,6,12,15-tetraen-2-amine |
| SMILES | C=C(CCC/C=C/CCCC/C=C/C/C=C/CCCCC)NC |
| InChI | InChI=1S/C22H39N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(2)23-3/h8-9,11-12,17-18,23H,2,4-7,10,13-16,19-21H2,1,3H3/b9-8+,12-11+,18-17+ |
| InChIKey | XLIGAVYWQIMEDQ-BDZZVDEESA-N |
| XLogP | 7.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.56 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|