C22H24Cl2F2N2O4 — CID 166896201
5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-N-[(4-chloro-3-fluorophenyl)methyl]-N-(2-hydroxyethyl)pentanamide (PubChem CID 166896201) has the molecular formula C22H24Cl2F2N2O4 and a molecular weight of 489.35 g/mol. Its IUPAC name is 5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-N-[(4-chloro-3-fluorophenyl)methyl]-N-(2-hydroxyethyl)pentanamide.
| Compound Name | 5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-N-[(4-chloro-3-fluorophenyl)methyl]-N-(2-hydroxyethyl)pentanamide |
|---|---|
| PubChem CID | 166896201 |
| Molecular Formula | C22H24Cl2F2N2O4 |
| Molecular Weight | 489.35 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-N-[(4-chloro-3-fluorophenyl)methyl]-N-(2-hydroxyethyl)pentanamide |
| SMILES | O=C(COc1ccc(Cl)c(F)c1)NCCCCC(=O)N(CCO)Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C22H24Cl2F2N2O4/c23-17-6-4-15(11-19(17)25)13-28(9-10-29)22(31)3-1-2-8-27-21(30)14-32-16-5-7-18(24)20(26)12-16/h4-7,11-12,29H,1-3,8-10,13-14H2,(H,27,30) |
| InChIKey | VWKJYEJKWRNODA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|