C21H21ClF4N4O5 — CID 166896199
N'-[[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]methyl]-N'-(2-hydroxyethyl)-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]propanediamide (PubChem CID 166896199) has the molecular formula C21H21ClF4N4O5 and a molecular weight of 520.87 g/mol. Its IUPAC name is N'-[[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]methyl]-N'-(2-hydroxyethyl)-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]propanediamide.
| Compound Name | N'-[[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]methyl]-N'-(2-hydroxyethyl)-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]propanediamide |
|---|---|
| PubChem CID | 166896199 |
| Molecular Formula | C21H21ClF4N4O5 |
| Molecular Weight | 520.87 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | N'-[[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]methyl]-N'-(2-hydroxyethyl)-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]propanediamide |
| SMILES | O=C(COc1ccc(Cl)c(F)c1)NCN(CCO)C(=O)CC(=O)NCc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C21H21ClF4N4O5/c22-16-4-3-15(7-17(16)23)35-11-19(33)29-12-30(5-6-31)20(34)8-18(32)28-10-14-2-1-13(9-27-14)21(24,25)26/h1-4,7,9,31H,5-6,8,10-12H2,(H,28,32)(H,29,33) |
| InChIKey | DKOPKEJLVMRKJD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.87 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|