C24H25ClF4N4O5 — CID 170082964
(Z)-5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-formyl-5-[2-hydroxyethyl(methyl)amino]-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]pent-3-enamide (PubChem CID 170082964) has the molecular formula C24H25ClF4N4O5 and a molecular weight of 560.93 g/mol. Its IUPAC name is (Z)-5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-formyl-5-[2-hydroxyethyl(methyl)amino]-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]pent-3-enamide.
| Compound Name | (Z)-5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-formyl-5-[2-hydroxyethyl(methyl)amino]-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]pent-3-enamide |
|---|---|
| PubChem CID | 170082964 |
| Molecular Formula | C24H25ClF4N4O5 |
| Molecular Weight | 560.93 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | (Z)-5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-formyl-5-[2-hydroxyethyl(methyl)amino]-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]pent-3-enamide |
| SMILES | CN(CCO)C(/C=C\C(C=O)C(=O)NCc1ccc(C(F)(F)F)cn1)NC(=O)COc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C24H25ClF4N4O5/c1-33(8-9-34)21(32-22(36)14-38-18-5-6-19(25)20(26)10-18)7-2-15(13-35)23(37)31-12-17-4-3-16(11-30-17)24(27,28)29/h2-7,10-11,13,15,21,34H,8-9,12,14H2,1H3,(H,31,37)(H,32,36)/b7-2- |
| InChIKey | YJQAAEXFYFECKZ-UQCOIBPSSA-N |
| XLogP | 2.33 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.93 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|