C22H22ClF4N3O4 — CID 166896206
5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-ethenyl-2-hydroxy-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]pentanamide (PubChem CID 166896206) has the molecular formula C22H22ClF4N3O4 and a molecular weight of 503.88 g/mol. Its IUPAC name is 5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-ethenyl-2-hydroxy-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]pentanamide.
| Compound Name | 5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-ethenyl-2-hydroxy-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]pentanamide |
|---|---|
| PubChem CID | 166896206 |
| Molecular Formula | C22H22ClF4N3O4 |
| Molecular Weight | 503.88 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | 5-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-2-ethenyl-2-hydroxy-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]pentanamide |
| SMILES | C=CC(O)(CCCNC(=O)COc1ccc(Cl)c(F)c1)C(=O)NCc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C22H22ClF4N3O4/c1-2-21(33,20(32)30-12-15-5-4-14(11-29-15)22(25,26)27)8-3-9-28-19(31)13-34-16-6-7-17(23)18(24)10-16/h2,4-7,10-11,33H,1,3,8-9,12-13H2,(H,28,31)(H,30,32) |
| InChIKey | KPQYMLGLQUVVMU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.88 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|