C9H16LiN — CID 16689765
lithium (3aR,7aR)-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-1-ide (PubChem CID 16689765) has the molecular formula C9H16LiN and a molecular weight of 145.18 g/mol. Its IUPAC name is lithium (3aR,7aR)-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-1-ide.
| Compound Name | lithium (3aR,7aR)-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-1-ide |
|---|---|
| PubChem CID | 16689765 |
| Molecular Formula | C9H16LiN |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.14 |
| IUPAC Name | lithium (3aR,7aR)-2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-1-ide |
| SMILES | CN1[CH-][C@@H]2CCCC[C@H]2C1.[Li+] |
| InChI | InChI=1S/C9H16N.Li/c1-10-6-8-4-2-3-5-9(8)7-10;/h6,8-9H,2-5,7H2,1H3;/q-1;+1/t8-,9-;/m0./s1 |
| InChIKey | ZDNBGFZITNTILO-OZZZDHQUSA-N |
| XLogP | -1.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|