C19H34O4 — CID 166898868
(5-hydroxy-2,7,7,10,10-pentamethyl-11-oxododec-8-en-3-yl) acetate (PubChem CID 166898868) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is (5-hydroxy-2,7,7,10,10-pentamethyl-11-oxododec-8-en-3-yl) acetate.
| Compound Name | (5-hydroxy-2,7,7,10,10-pentamethyl-11-oxododec-8-en-3-yl) acetate |
|---|---|
| PubChem CID | 166898868 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (5-hydroxy-2,7,7,10,10-pentamethyl-11-oxododec-8-en-3-yl) acetate |
| SMILES | CC(=O)OC(CC(O)CC(C)(C)C=CC(C)(C)C(C)=O)C(C)C |
| InChI | InChI=1S/C19H34O4/c1-13(2)17(23-15(4)21)11-16(22)12-18(5,6)9-10-19(7,8)14(3)20/h9-10,13,16-17,22H,11-12H2,1-8H3 |
| InChIKey | YAXHOBDIVWRJLB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|