About 4-[benzyl(bromo)amino]-2,6-dimethylbenzaldehyde
4-[benzyl(bromo)amino]-2,6-dimethylbenzaldehyde (PubChem CID 166904568) has the molecular formula C16H16BrNO
and a molecular weight of 318.21 g/mol. Its IUPAC name is 4-[benzyl(bromo)amino]-2,6-dimethylbenzaldehyde.
Molecular Properties
| Compound Name | 4-[benzyl(bromo)amino]-2,6-dimethylbenzaldehyde |
| PubChem CID | 166904568 |
| Molecular Formula | C16H16BrNO |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 4-[benzyl(bromo)amino]-2,6-dimethylbenzaldehyde |
| SMILES | Cc1cc(N(Br)Cc2ccccc2)cc(C)c1C=O |
| InChI | InChI=1S/C16H16BrNO/c1-12-8-15(9-13(2)16(12)11-19)18(17)10-14-6-4-3-5-7-14/h3-9,11H,10H2,1-2H3 |
| InChIKey | MUILMJHAZPBCGJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-[benzyl(bromo)amino]-2,6-dimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[benzyl(bromo)amino]-2,6-dimethylbenzaldehyde?
The IUPAC name of 4-[benzyl(bromo)amino]-2,6-dimethylbenzaldehyde (CID 166904568) is 4-[benzyl(bromo)amino]-2,6-dimethylbenzaldehyde.
What is the SMILES notation for 4-[benzyl(bromo)amino]-2,6-dimethylbenzaldehyde?
The canonical SMILES for 4-[benzyl(bromo)amino]-2,6-dimethylbenzaldehyde is Cc1cc(N(Br)Cc2ccccc2)cc(C)c1C=O.
What is the InChIKey of 4-[benzyl(bromo)amino]-2,6-dimethylbenzaldehyde?
The InChIKey is MUILMJHAZPBCGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16BrNO/c1-12-8-15(9-13(2)16(12)11-19)18(17)10-14-6-4-3-5-7-14/h3-9,11H,10H2,1-2H3.
What are the key properties of 4-[benzyl(bromo)amino]-2,6-dimethylbenzaldehyde?
4-[benzyl(bromo)amino]-2,6-dimethylbenzaldehyde has a molecular weight of 318.21 g/mol, XLogP of 4.43, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[benzyl(bromo)amino]-2,6-dimethylbenzaldehyde is sourced from PubChem (CID 166904568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).