C30H43NO2 — CID 166904899
[(3S,8S,9S,10R,13R,14S)-10,13-dimethyl-17-[(2R)-5-phenylpentan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] nitrite (PubChem CID 166904899) has the molecular formula C30H43NO2 and a molecular weight of 449.68 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13R,14S)-10,13-dimethyl-17-[(2R)-5-phenylpentan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] nitrite.
| Compound Name | [(3S,8S,9S,10R,13R,14S)-10,13-dimethyl-17-[(2R)-5-phenylpentan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] nitrite |
|---|---|
| PubChem CID | 166904899 |
| Molecular Formula | C30H43NO2 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.33 |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S)-10,13-dimethyl-17-[(2R)-5-phenylpentan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] nitrite |
| SMILES | C[C@H](CCCc1ccccc1)C1CC[C@H]2[C@@H]3CC=C4C[C@@H](ON=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H43NO2/c1-21(8-7-11-22-9-5-4-6-10-22)26-14-15-27-25-13-12-23-20-24(33-31-32)16-18-29(23,2)28(25)17-19-30(26,27)3/h4-6,9-10,12,21,24-28H,7-8,11,13-20H2,1-3H3/t21-,24+,25+,26?,27+,28+,29+,30-/m1/s1 |
| InChIKey | NMPVTUTVWFHDJZ-ZOILWZHKSA-N |
| XLogP | 8.29 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|